CAS 874-96-4
:(3-methyl-1,1-dioxidotetrahydrothiophen-3-yl)hydrazine
Description:
(3-methyl-1,1-dioxidotetrahydrothiophen-3-yl)hydrazine, with the CAS number 874-96-4, is a chemical compound characterized by its unique structure that includes a tetrahydrothiophene ring and a hydrazine functional group. This compound features a sulfur atom within a saturated ring, contributing to its potential reactivity and properties. The presence of the hydrazine moiety indicates that it may exhibit properties typical of hydrazines, such as being a reducing agent and having potential applications in organic synthesis and pharmaceuticals. The dioxido group suggests that the compound may have enhanced stability or specific reactivity patterns due to the presence of oxygen atoms. Generally, compounds of this nature can be sensitive to air and moisture, necessitating careful handling and storage. Its specific applications and behavior in chemical reactions would depend on the context of use, including the presence of other reactants and the conditions under which reactions are conducted. Overall, this compound represents a class of chemicals that may have diverse applications in various fields, including medicinal chemistry and materials science.
Formula:C5H12N2O2S
InChI:InChI=1/C5H12N2O2S/c1-5(7-6)2-3-10(8,9)4-5/h7H,2-4,6H2,1H3
SMILES:CC1(CCS(=O)(=O)C1)NN
Synonyms:- Hydrazine, (Tetrahydro-3-Methyl-1,1-Dioxido-3-Thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
