CymitQuimica logo

CAS 874013-98-6

:

7-Chloro-2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine

Description:
7-Chloro-2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 7-position and two methyl groups at the 2 and 3 positions enhances its reactivity and solubility in organic solvents. This compound typically exhibits a pale yellow to brownish color and is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. Additionally, the compound's stability and reactivity can be affected by the electronic effects of the chlorine and methyl substituents. As with many heterocycles, it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C9H9ClN2
InChI:InChI=1S/C9H9ClN2/c1-5-6(2)12-8-7(5)3-4-11-9(8)10/h3-4,12H,1-2H3
InChI key:InChIKey=UCCNDSDAFBMASX-UHFFFAOYSA-N
SMILES:CC=1C=2C(=C(Cl)N=CC2)NC1C
Synonyms:
  • 7-Chloro-2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine
  • 1H-Pyrrolo[2,3-c]pyridine, 7-chloro-2,3-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.