CAS 87402-88-8

(+)-Denudatin B

Description:

(+)-Denudatin B is a naturally occurring alkaloid that belongs to the class of compounds known as isoquinoline alkaloids. It is primarily derived from certain plant species, particularly those in the family of Menispermaceae. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. (+)-Denudatin B has been studied for its potential pharmacological properties, including anti-inflammatory and analgesic effects. Its stereochemistry is significant, as the specific configuration of its chiral centers can influence its biological interactions and efficacy. The compound is typically isolated through extraction and purification processes from plant sources, and its chemical properties, such as solubility and stability, can vary depending on environmental conditions. Research into (+)-Denudatin B continues to explore its therapeutic potential and mechanisms of action, making it a subject of interest in natural product chemistry and pharmacology.

Formula: C₂₁H₂₄O₅

InChI: InChI=1/C21H24O5/c1-6-7-15-12-21(25-5)13(2)20(26-19(21)11-16(15)22)14-8-9-17(23-3)18(10-14)24-4/h6,8-13,20H,1,7H2,2-5H3/t13-,20+,21-/m1/s1

InChI key: InChIKey=VDYACOATPFOZIO-HBUDHLSFSA-N

SMILES: O(C)[C@@]12C(O[C@@H]([C@H]1C)C3=CC(OC)=C(OC)C=C3)=CC(=O)C(CC=C)=C2

Synonyms:

• (2S,3R,3aR)-2-(3,4-Dimethoxyphenyl)-3,3a-dihydro-3a-methoxy-3-methyl-5-(2-propen-1-yl)-6(2H)-benzofuranone
• 6(2H)-Benzofuranone, 2-(3,4-dimethoxyphenyl)-3,3a-dihydro-3a-methoxy-3-methyl-5-(2-propen-1-yl)-, (2S,3R,3aR)-
• 6(2H)-Benzofuranone, 2-(3,4-dimethoxyphenyl)-3,3a-dihydro-3a-methoxy-3-methyl-5-(2-propenyl)-, (2S,3R,3aR)-
• 6(2H)-Benzofuranone, 2-(3,4-dimethoxyphenyl)-3,3a-dihydro-3a-methoxy-3-methyl-5-(2-propenyl)-, [2S-(2α,3β,3aβ)]-
• Denudatin B
• C10554
• (2S,3R,3aS)-2-(3,4-dimethoxyphenyl)-3a-methoxy-3-methyl-5-prop-2-enyl-2,3-dihydrobenzofuran-6-one

Denudatin B

CAS: 87402-88-8

Formula: C₂₁H₂₄O₅

Purity: 95%

Molecular weight: 356.4123

Ref: IN-DA008DSK

(-)-Denudatin B

CAS: 87402-88-8

(-)-Denudatin B

Purity: ≥95%

Molecular weight: 356.41g/mol

Ref: 54-BUP00801

(-)-Denudatin B

CAS: 87402-88-8

Denudatin B, from Magnolia fargesii, inhibits platelets via phosphoinositide breakdown blockage.

Formula: C₂₁H₂₄O₅

Purity: 99.69%

Color and Shape: Solid

Molecular weight: 356.41

Ref: TM-TN3831

Denudatin B

CAS: 87402-88-8

Formula: C₂₁H₂₄O₅

Purity: 95%~99%

Molecular weight: 356.418

Ref: BP-SBP02516

Denudatin B

CAS: 87402-88-8

Denudatin B is an indole alkaloid, which is a natural compound derived from various plant species. It is primarily isolated from the plant genus Mappia, known for its rich alkaloidal content. The mode of action of Denudatin B involves interference with cellular signaling pathways, which can induce apoptosis and inhibit proliferation in certain types of cancer cells. This compound has been found to disrupt the function of microtubules, integral components of the cell's cytoskeleton, thereby preventing proper cell division and leading to cell death in rapidly dividing cancerous cells.

Formula: C₂₁H₂₄O₅

Purity: Min. 95%

Molecular weight: 356.4 g/mol

Ref: 3D-MDA40288