CAS 87402-91-3
:2-[2,4-dihydroxy-5-(3-methylbut-2-en-1-yl)phenyl]-5,7-dihydroxy-8-(3-methylbut-2-en-1-yl)-2,3-dihydro-4H-chromen-4-one
Description:
The chemical substance known as "2-[2,4-dihydroxy-5-(3-methylbut-2-en-1-yl)phenyl]-5,7-dihydroxy-8-(3-methylbut-2-en-1-yl)-2,3-dihydro-4H-chromen-4-one," with the CAS number 87402-91-3, is a flavonoid compound characterized by its complex polyphenolic structure. It features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of the 3-methylbut-2-en-1-yl substituents indicates that it may exhibit unique biological activities, possibly enhancing its interaction with biological systems. This compound is likely to be soluble in organic solvents and may have limited solubility in water due to its hydrophobic regions. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of natural products with health benefits, such as anti-inflammatory or anticancer properties. Additionally, the presence of multiple aromatic rings enhances its stability and reactivity, making it a subject of interest in various fields, including medicinal chemistry and natural product research.
Formula:C25H28O6
InChI:InChI=1/C25H28O6/c1-13(2)5-7-15-9-17(20(28)10-18(15)26)23-12-22(30)24-21(29)11-19(27)16(25(24)31-23)8-6-14(3)4/h5-6,9-11,23,26-29H,7-8,12H2,1-4H3
SMILES:CC(=CCc1cc(c(cc1O)O)C1CC(=O)c2c(cc(c(CC=C(C)C)c2O1)O)O)C
Synonyms:- 4H-1-benzopyran-4-one, 2-[2,4-dihydroxy-5-(3-methyl-2-buten-1-yl)phenyl]-2,3-dihydro-5,7-dihydroxy-8-(3-methyl-2-buten-1-yl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Euchrestaflavanone B
CAS:Euchrestaflavanone B has antibacterial effects on Gram-positive bacteria and may inhibit cancer by targeting protein kinase CKII.Formula:C25H28O6Purity:98%Color and Shape:SolidMolecular weight:424.49Euchrestaflavanone B
CAS:Euchrestaflavanone B is a naturally occurring flavonoid, which is a type of polyphenolic compound. It is primarily sourced from various plant species, particularly those found in the Leguminosae family. The mode of action of Euchrestaflavanone B involves its interaction with cellular signaling pathways, where it exhibits a broad spectrum of bioactive effects. These include anti-inflammatory, antioxidant, and anticancer properties, potentially through modulation of enzyme activities and gene expression.Formula:C25H28O6Purity:Min. 95%Molecular weight:424.5 g/mol


