CymitQuimica logo

CAS 87405-61-6

:

6-(trifluoromethyl)-1,2,3,4-tetrahydro-1,4-methanonaphthalen-9-amine

Description:
6-(Trifluoromethyl)-1,2,3,4-tetrahydro-1,4-methanonaphthalen-9-amine, with the CAS number 87405-61-6, is a chemical compound characterized by its complex bicyclic structure, which includes a tetrahydronaphthalene framework. The presence of a trifluoromethyl group (-CF3) significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its reactivity and biological activity. This compound features an amine functional group, which can participate in hydrogen bonding and may contribute to its solubility in polar solvents. The tetrahydro configuration indicates that the compound is saturated, which can impact its stability and reactivity compared to unsaturated analogs. Additionally, the trifluoromethyl group is known for imparting unique electronic properties, making such compounds of interest in medicinal chemistry and materials science. Overall, this compound's structural features suggest potential applications in pharmaceuticals or as a building block in organic synthesis, although specific applications would depend on further research into its biological activity and reactivity.
Formula:C12H12F3N
InChI:InChI=1/C12H12F3N/c13-12(14,15)6-1-2-7-8-3-4-9(11(8)16)10(7)5-6/h1-2,5,8-9,11H,3-4,16H2
SMILES:c1cc2C3CCC(c2cc1C(F)(F)F)C3N
Synonyms:
  • 1,4-Methanonaphthalen-9-Amine, 1,2,3,4-Tetrahydro-6-(Trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.