CAS 874098-11-0

(αS)-α-Ethyl-3-nitrobenzenemethanamine

Description:

(αS)-α-Ethyl-3-nitrobenzenemethanamine, identified by its CAS number 874098-11-0, is an organic compound characterized by its specific structural features. It contains an ethyl group and a nitro group attached to a benzene ring, which contributes to its chemical reactivity and potential applications. The presence of the amino group (-NH2) indicates that it can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The stereochemistry of the compound, denoted by the (αS) configuration, suggests that it has a specific spatial arrangement that may influence its biological activity and interactions with other molecules. This compound may be of interest in pharmaceutical research, particularly in the development of new drugs or as an intermediate in organic synthesis. Its properties, such as solubility, melting point, and reactivity, would be influenced by the functional groups present and the overall molecular structure. As with many nitro-substituted compounds, it may exhibit distinct physical and chemical properties that warrant further investigation for practical applications.

Formula: C₉H₁₂N₂O₂

InChI: InChI=1S/C9H12N2O2/c1-2-9(10)7-4-3-5-8(6-7)11(12)13/h3-6,9H,2,10H2,1H3/t9-/m0/s1

InChI key: InChIKey=ONWQSIRAWSRGBH-VIFPVBQESA-N

SMILES: [C@@H](CC)(N)C1=CC(N(=O)=O)=CC=C1

Synonyms:

• Benzenemethanamine, α-ethyl-3-nitro-, (αS)-
• (αS)-α-Ethyl-3-nitrobenzenemethanamine