CAS 87411-31-2

4-[3-(Trifluoromethyl)phenoxy]butanoic acid

Description:

4-[3-(Trifluoromethyl)phenoxy]butanoic acid, identified by its CAS number 87411-31-2, is an organic compound characterized by its unique molecular structure, which includes a butanoic acid moiety linked to a phenoxy group that carries a trifluoromethyl substituent. This compound typically exhibits properties associated with both hydrophilicity and lipophilicity due to the presence of the carboxylic acid functional group and the aromatic ring, respectively. The trifluoromethyl group enhances the compound's stability and can influence its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Its potential applications may include serving as a herbicide or a plant growth regulator, owing to its ability to interact with specific biological pathways. Additionally, the presence of fluorine atoms often imparts unique electronic properties, which can affect the compound's reactivity and interaction with other substances. Overall, 4-[3-(Trifluoromethyl)phenoxy]butanoic acid is a compound of interest due to its distinctive chemical characteristics and potential applications.

Formula: C₁₁H₁₁F₃O₃

InChI: InChI=1S/C11H11F3O3/c12-11(13,14)8-3-1-4-9(7-8)17-6-2-5-10(15)16/h1,3-4,7H,2,5-6H2,(H,15,16)

InChI key: InChIKey=BROOMGSHOWKNNX-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(OCCCC(O)=O)=CC=C1

Synonyms:

• 4-[3-(Trifluoromethyl)phenoxy]butanoic acid
• Butanoic acid, 4-[3-(trifluoromethyl)phenoxy]-

4-[3-(Trifluoromethyl)phenoxy]butanoic acid

CAS: 87411-31-2

4-[3-(Trifluoromethyl)phenoxy]butanoic acid

Purity: ≥95%

Color and Shape: White Solid

Molecular weight: 248.20g/mol

Ref: 54-PC53533

4-(3-Trifluoromethyl-phenoxy)-butyric acid

Controlled Product

CAS: 87411-31-2

Please enquire for more information about 4-(3-Trifluoromethyl-phenoxy)-butyric acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₁H₁₁F₃O₃

Purity: Min. 95%

Molecular weight: 248.2 g/mol

Ref: 3D-MDA41131