CAS 874114-31-5
:2-Chloro-6-(1,3-dithian-2-yl)pyrazine
Description:
2-Chloro-6-(1,3-dithian-2-yl)pyrazine is a heterocyclic organic compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 2-position and a 1,3-dithian-2-yl group at the 6-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential reactivity due to the electron-withdrawing nature of the chlorine atom and the sulfur-containing dithiane group, which can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The compound may also possess interesting biological activities, making it of interest in medicinal chemistry and agrochemical applications. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-Chloro-6-(1,3-dithian-2-yl)pyrazine is a valuable compound for research in synthetic organic chemistry and related fields.
Formula:C8H9ClN2S2
InChI:InChI=1S/C8H9ClN2S2/c9-7-5-10-4-6(11-7)8-12-2-1-3-13-8/h4-5,8H,1-3H2
InChI key:InChIKey=GLZHTPZZLVJSJV-UHFFFAOYSA-N
SMILES:ClC=1N=C(C=NC1)C2SCCCS2
Synonyms:- 2-Chloro-6-(1,3-dithian-2-yl)pyrazine
- Pyrazine, 2-chloro-6-(1,3-dithian-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
