CAS 87421-23-6
:(2R,3S)-(-)-2-Amino-3-hydroxy-4-methylpentanoic acid
Description:
(2R,3S)-(-)-2-Amino-3-hydroxy-4-methylpentanoic acid, commonly known as L-threonine, is an essential amino acid that plays a crucial role in protein synthesis and various metabolic processes. It is characterized by its chiral centers, which contribute to its specific stereochemistry, making it biologically active. L-threonine is a polar molecule due to the presence of both amino and hydroxyl functional groups, which enhances its solubility in water. This amino acid is involved in the synthesis of proteins and is a precursor for other important biomolecules, including glycine and serine. It is also significant in the immune response and is utilized in various biochemical pathways. L-threonine is commonly found in various food sources, particularly in dairy products, meat, and certain grains. Its CAS number, 87421-23-6, is a unique identifier that facilitates its identification in chemical databases. Overall, L-threonine is vital for maintaining proper nutrition and supporting various physiological functions in living organisms.
Formula:C6H13NO3
InChI:InChI=1/C6H13NO3/c1-3(2)5(8)4(7)6(9)10/h3-5,8H,7H2,1-2H3,(H,9,10)/t4-,5+/m1/s1
Synonyms:- D(-)-threo-3-Hydroxyleucine
- (2R,3S)-2-amino-3-hydroxy-4-methylpentanoic acid (non-preferred name)
- D-Threo-Hydroxyleucine
- (2R,3S)-(-)-2-Amino-3-hydroxy-4-methylpentanoic acid,99.5+%,99+% ee
- (2R,3S)-3-Hydroxyleucine
- (2R,3S)-β-Hydroxyleucine
- threo-3-Hydroxy-D-leucine
- (2R,3S)-(-)-2-AMINO-3-HYDROXY-4-METHYLPENTANOIC ACID, 99+% E.E., 99.5+%
- (3S)-3-Hydroxy-D-leucine
- (2R,3S)-b-Hydroxyleucine
- (2R,3S)-(-)-2-Amino-3-hydroxy-4-methylpentanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2R,3S)-2-Amino-3-hydroxy-4-methylpentanoic acid
CAS:Formula:C6H13NO3Purity:98%Color and Shape:SolidMolecular weight:147.1723(2R,3S)-2-Amino-3-hydroxy-4-methylpentanoic acid
CAS:(2R,3S)-2-Amino-3-hydroxy-4-methylpentanoic acidPurity:98%(2R,3S)-2-Amino-3-hydroxy-4-methylpentanoic acid
CAS:Formula:C6H13NO3Purity:98%Molecular weight:147.174(2R,3S)-β-Hydroxyleucine
CAS:Controlled ProductApplications (2R,3S)-β-Hydroxyleucine is a nonprotein amino acid. (2R,3S)-β-Hydroxyleucineis an inhibitor of serine protease. In particular, (2R,3S)-β-Hydroxyleucine was effective in inhibiting trypsin and proteinase K of the serine proteases group. (2R,3S)-β-Hydroxyleucine was not able to inhibit the growth of gram-positive and gram-negative bacteria and yeasts unlike its (2S,3R)-isomer.
References Hovhannisyan, N. et al.: Amino Acids, 37, 531 (2009); Chitchyan, M.B. et al.: Hayas. Kensab. Hand., 59, 248 (2007);Formula:C6H13NO3Color and Shape:NeatMolecular weight:147.172




