CAS 874219-16-6
:[2-(dimethylcarbamoyl)phenyl]boronic acid
Description:
[2-(Dimethylcarbamoyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a dimethylcarbamoyl group. This compound typically exhibits properties such as moderate solubility in polar organic solvents and can participate in various chemical reactions, including Suzuki coupling, which is significant in organic synthesis and medicinal chemistry. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in the development of sensors and drug delivery systems. Additionally, the dimethylcarbamoyl group can influence the compound's reactivity and stability, potentially enhancing its biological activity. The compound's structure suggests it may have applications in pharmaceuticals, particularly in the development of targeted therapies due to its ability to interact with biological molecules. Overall, [2-(dimethylcarbamoyl)phenyl]boronic acid is a versatile compound with potential utility in various fields of chemistry and biochemistry.
Formula:C9H12BNO3
InChI:InChI=1/C9H12BNO3/c1-11(2)9(12)7-5-3-4-6-8(7)10(13)14/h3-6,13-14H,1-2H3
SMILES:CN(C)C(=O)c1ccccc1B(O)O
Synonyms:- 2-(N,N-Dimethylaminocarbonyl)Benzeneboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(Dimethylcarbamoyl)benzeneboronic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H12BNO3Purity:95%Molecular weight:193.012-(N,N-Dimethylaminocarbonyl)phenylboronic acid
CAS:Formula:C9H12BNO3Color and Shape:SolidMolecular weight:193.00752-(Dimethylcarbamoyl)benzeneboronic acid
CAS:2-(Dimethylcarbamoyl)benzeneboronic acidFormula:C9H12BNO3Purity:95%Color and Shape: off white solidMolecular weight:193.01g/mol


