CAS 874219-23-5

B-[3-[(Butylamino)carbonyl]-4-fluorophenyl]boronic acid

Description:

B-[3-[(Butylamino)carbonyl]-4-fluorophenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a fluorinated aromatic ring, which can enhance its electronic properties and reactivity. The butylamino group contributes to its solubility and potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The boronic acid moiety is often utilized in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Additionally, the presence of the fluorine atom can influence the compound's lipophilicity and metabolic stability. Overall, this compound's unique structural features make it a valuable candidate for various applications in organic synthesis and drug development. As with many boronic acids, it is important to handle it with care due to its reactivity and potential environmental impact.

Formula: C₁₁H₁₅BFNO₃

InChI: InChI=1S/C11H15BFNO3/c1-2-3-6-14-11(15)9-7-8(12(16)17)4-5-10(9)13/h4-5,7,16-17H,2-3,6H2,1H3,(H,14,15)

InChI key: InChIKey=FYINHVVQWXVREN-UHFFFAOYSA-N

SMILES: C(NCCCC)(=O)C1=CC(B(O)O)=CC=C1F

Synonyms:

• Boronic acid, [3-[(butylamino)carbonyl]-4-fluorophenyl]-
• Boronic acid, B-[3-[(butylamino)carbonyl]-4-fluorophenyl]-
• B-[3-[(Butylamino)carbonyl]-4-fluorophenyl]boronic acid

3-(N-BUTYLCARBAMOYL)-4-FLUOROBENZENEBORONIC ACID

CAS: 874219-23-5

Formula: C₁₁H₁₅BFNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 239.0511

Ref: IN-DA008DKO

3-(Butylcarbamoyl)-4-fluorobenzeneboronic acid

CAS: 874219-23-5

3-(Butylcarbamoyl)-4-fluorobenzeneboronic acid

Purity: 98%

Molecular weight: 239.05g/mol

Ref: 54-PC5017

(3-(Butylcarbamoyl)-4-fluorophenyl)boronic acid

CAS: 874219-23-5

Formula: C₁₁H₁₅BFNO₃

Purity: 95%

Molecular weight: 239.05

Ref: 10-F219684