CAS 874219-34-8
:(3-carbamoyl-4-fluoro-phenyl)boronic acid
Description:
(3-Carbamoyl-4-fluoro-phenyl)boronic acid is an organic compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a carbamoyl group and a fluorine atom, which can influence its reactivity and biological activity. The boronic acid moiety contributes to its potential as a ligand in various catalytic processes and as a building block in the synthesis of complex molecules. Additionally, the presence of the fluorine atom may enhance the compound's lipophilicity and metabolic stability, making it of interest in drug design. Its structural characteristics suggest potential applications in areas such as pharmaceuticals, agrochemicals, and materials science. As with many boronic acids, it is important to handle this compound with care due to its reactivity and potential environmental impact.
Formula:C7H7BFNO3
InChI:InChI=1/C7H7BFNO3/c9-6-2-1-4(8(12)13)3-5(6)7(10)11/h1-3,12-13H,(H2,10,11)
SMILES:c1cc(c(cc1B(O)O)C(=N)O)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Carbamoyl-4-fluorobenzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H7BFNO3Purity:97%Molecular weight:182.953-(Aminocarbonyl)-4-fluorobenzeneboronic acid
CAS:Formula:C7H7BFNO3Purity:97%Color and Shape:SolidMolecular weight:182.94483-Carbamoyl-4-fluorobenzeneboronic acid
CAS:3-Carbamoyl-4-fluorobenzeneboronic acidPurity:97%Color and Shape:PowderMolecular weight:182.94g/mol(3-Carbamoyl-4-fluorophenyl)boronic acid
CAS:Formula:C7H7BFNO3Purity:97%Color and Shape:SolidMolecular weight:182.95



