
CAS 87427-60-9
:2-Bromo-1-(4-bromo-3,5-dichlorophenyl)ethanone
Description:
2-Bromo-1-(4-bromo-3,5-dichlorophenyl)ethanone, with the CAS number 87427-60-9, is an organic compound characterized by its complex halogenated structure. It features a bromine atom and a dichlorophenyl group, which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of multiple halogens, specifically bromine and chlorine, enhances its electrophilic properties, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity can be influenced by the electron-withdrawing effects of the halogen substituents, which can stabilize certain reaction intermediates. Safety considerations are important when handling this compound due to its halogenated nature, which may pose environmental and health risks. Proper storage and handling protocols should be followed to mitigate any hazards associated with its use.
Formula:C8H4Br2Cl2O
InChI:InChI=1S/C8H4Br2Cl2O/c9-3-7(13)4-1-5(11)8(10)6(12)2-4/h1-2H,3H2
InChI key:InChIKey=KJJCYPXARCXLPQ-UHFFFAOYSA-N
SMILES:C(CBr)(=O)C1=CC(Cl)=C(Br)C(Cl)=C1
Synonyms:- Ethanone, 2-bromo-1-(4-bromo-3,5-dichlorophenyl)-
- 2-Bromo-1-(4-bromo-3,5-dichlorophenyl)ethanone
- 2-Bromo-1-(4-bromo-3,5-dichlorophenyl)ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.