CAS 87427-61-0
:2-Bromo-1-(3,4-dichlorophenyl)-1-propanone
Description:
2-Bromo-1-(3,4-dichlorophenyl)-1-propanone is an organic compound characterized by its bromine and dichlorophenyl substituents on a propanone backbone. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. The 3,4-dichlorophenyl group adds to its complexity, influencing both its physical properties and reactivity. Typically, compounds of this nature are solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of halogens often affects the compound's stability, boiling point, and melting point. Additionally, 2-Bromo-1-(3,4-dichlorophenyl)-1-propanone may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals, highlighting its significance in medicinal chemistry and material science. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.
Formula:C9H7BrCl2O
InChI:InChI=1S/C9H7BrCl2O/c1-5(10)9(13)6-2-3-7(11)8(12)4-6/h2-5H,1H3
InChI key:InChIKey=YPKHWACIODYBCI-UHFFFAOYSA-N
SMILES:C(C(Br)C)(=O)C1=CC(Cl)=C(Cl)C=C1
Synonyms:- 1-Bromoethyl 3,4-dichlorophenyl ketone
- 2-Bromo-1-(3,4-dichlorophenyl)propan-1-one
- 1-Propanone, 2-bromo-1-(3,4-dichlorophenyl)-
- 2-Bromo-1-(3,4-dichlorophenyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Bromo-1-(3,4-dichlorophenyl)propan-1-one
CAS:Formula:C9H7BrCl2OColor and Shape:SolidMolecular weight:281.9613

