CAS 874279-27-3
:4-Pyrimidinecarboxaldehyde, 2-(methylsulfonyl)-
Description:
4-Pyrimidinecarboxaldehyde, 2-(methylsulfonyl)- is an organic compound characterized by the presence of a pyrimidine ring, an aldehyde functional group, and a methylsulfonyl substituent. The molecular structure features a pyrimidine base, which is a six-membered heterocyclic compound containing two nitrogen atoms at positions 1 and 3. The aldehyde group, located at the 4-position of the pyrimidine ring, contributes to its reactivity, allowing it to participate in various chemical reactions, such as condensation and nucleophilic addition. The methylsulfonyl group, attached at the 2-position, enhances the compound's solubility in polar solvents and may influence its biological activity. This compound is of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Its unique combination of functional groups may also impart specific properties, such as increased stability or reactivity, making it a valuable compound for research and industrial applications.
Formula:C6H6N2O3S
InChI:InChI=1/C6H6N2O3S/c1-12(10,11)6-7-3-2-5(4-9)8-6/h2-4H,1H3
SMILES:CS(=O)(=O)c1nccc(C=O)n1
Synonyms:- 2-(Methylsulfonyl)-4-pyrimidinecarbaldehyde
- 2-(Methylsulfonyl)Pyrimidine-4-Carbaldehyde
- 2-Methanesulfonyl-pyrimidine-4-carbaldehyde
- 4-pyrimidinecarboxaldehyde, 2-(methylsulfonyl)-
- 2-Methylsulfonylpyrimidine-4-carboxaldehyde
- 2-Methanesulfonyl-pyrimidine-4-carbaldehyde ISO 9001：2015 REACH
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
