CAS 874279-86-4
:2,2-Difluoro-2,3-dihydro-1H-inden-1-one
Description:
2,2-Difluoro-2,3-dihydro-1H-inden-1-one is an organic compound characterized by its unique bicyclic structure, which includes a fused indene and carbonyl group. The presence of two fluorine atoms at the 2-position of the indene ring significantly influences its chemical properties, including increased electronegativity and potential reactivity. This compound typically exhibits a pale yellow to colorless appearance and is soluble in organic solvents. Its molecular structure contributes to its potential applications in pharmaceuticals and agrochemicals, where fluorinated compounds often exhibit enhanced biological activity. The carbonyl group in the structure can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. Additionally, the compound's stability and reactivity can be affected by the steric and electronic effects of the fluorine substituents. Overall, 2,2-Difluoro-2,3-dihydro-1H-inden-1-one is a notable compound in synthetic organic chemistry, particularly for its potential utility in developing new materials and biologically active molecules.
Formula:C9H6F2O
InChI:InChI=1S/C9H6F2O/c10-9(11)5-6-3-1-2-4-7(6)8(9)12/h1-4H,5H2
InChI key:InChIKey=XMKSUSDXUVEUJT-UHFFFAOYSA-N
SMILES:O=C1C=2C(CC1(F)F)=CC=CC2
Synonyms:- 2,2-Difluoroindan-1-one
- 1H-Inden-1-one, 2,2-difluoro-2,3-dihydro-
- 1H-Inden-1-one, 2,2-difluoro-2,3-dihydro-
- 2,2-Difluoro-2,3-dihydro-1H-inden-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
