
CAS 87428-53-3
:2-Hydroxy-1-(3,4,5-trimethoxyphenyl)ethanone
Description:
2-Hydroxy-1-(3,4,5-trimethoxyphenyl)ethanone, also known by its CAS number 87428-53-3, is an organic compound characterized by its phenolic structure and ketone functional group. This compound features a hydroxyl group (-OH) attached to a carbon adjacent to a carbonyl group (C=O), making it a hydroxy ketone. The presence of three methoxy groups (-OCH3) on the aromatic ring significantly influences its chemical properties, enhancing its solubility in organic solvents and potentially affecting its reactivity and biological activity. The methoxy substituents can also contribute to the compound's electron-donating characteristics, which may impact its interaction with other molecules. 2-Hydroxy-1-(3,4,5-trimethoxyphenyl)ethanone may exhibit various biological activities, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential applications in the development of pharmaceuticals or as a biochemical probe. However, specific details regarding its stability, reactivity, and biological effects would require further investigation through experimental studies.
Formula:C11H14O5
InChI:InChI=1S/C11H14O5/c1-14-9-4-7(8(13)6-12)5-10(15-2)11(9)16-3/h4-5,12H,6H2,1-3H3
InChI key:InChIKey=POXBLWNPHHZUJF-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=C(C(CO)=O)C=C1OC
Synonyms:- 2-Hydroxy-1-(3,4,5-trimethoxyphenyl)ethanone
- Acetophenone, 2-hydroxy-3′,4′,5′-trimethoxy-
- Ethanone, 2-hydroxy-1-(3,4,5-trimethoxyphenyl)-
- 2-Hydroxy-1-(3,4,5-trimethoxyphenyl)ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.