CymitQuimica logo

CAS 87428-99-7

:

N-[1-Oxo-2-(phenylmethyl)-2-propen-1-yl]glycine phenylmethyl ester

Description:
N-[1-Oxo-2-(phenylmethyl)-2-propen-1-yl]glycine phenylmethyl ester, with the CAS number 87428-99-7, is an organic compound characterized by its structure, which includes a glycine derivative with a phenylmethyl group and an α,β-unsaturated carbonyl moiety. This compound typically exhibits properties associated with both amides and esters, including potential reactivity due to the presence of the carbonyl group, which can participate in various chemical reactions such as nucleophilic addition or condensation. The phenylmethyl groups contribute to its hydrophobic character, influencing its solubility in organic solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug design. Its stability and reactivity can be affected by environmental conditions such as pH and temperature. Overall, this compound represents a class of molecules that can be explored for various applications in synthetic organic chemistry and pharmacology.
Formula:C19H19NO3
InChI:InChI=1S/C19H19NO3/c1-15(12-16-8-4-2-5-9-16)19(22)20-13-18(21)23-14-17-10-6-3-7-11-17/h2-11H,1,12-14H2,(H,20,22)
InChI key:InChIKey=YKINYFHTXSOMQZ-UHFFFAOYSA-N
SMILES:C(C(C(NCC(OCC1=CC=CC=C1)=O)=O)=C)C2=CC=CC=C2
Synonyms:
  • Glycine, N-[1-oxo-2-(phenylmethyl)-2-propenyl]-, phenylmethyl ester
  • Glycine, N-[1-oxo-2-(phenylmethyl)-2-propen-1-yl]-, phenylmethyl ester
  • N-[1-Oxo-2-(phenylmethyl)-2-propen-1-yl]glycine phenylmethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.