CAS 874285-03-7

2-(3-bromo-2-fluoro-phenyl)acetonitrile

Description:

2-(3-Bromo-2-fluoro-phenyl)acetonitrile is an organic compound characterized by its unique structure, which includes a phenyl ring substituted with both bromine and fluorine atoms, as well as a nitrile functional group. The presence of the bromine and fluorine substituents contributes to its chemical reactivity and potential applications in pharmaceuticals and agrochemicals. This compound typically exhibits moderate polarity due to the nitrile group, which can influence its solubility in various solvents. The bromine atom can enhance the compound's electrophilic character, while the fluorine atom may impart unique electronic properties. Additionally, the acetonitrile moiety suggests potential for participation in nucleophilic reactions. The compound's CAS number, 874285-03-7, allows for easy identification in chemical databases and literature. Overall, 2-(3-bromo-2-fluoro-phenyl)acetonitrile is of interest for its synthetic utility and potential biological activity, making it a subject of study in various fields of chemistry.

Formula: C₈H₅BrFN

InChI: InChI=1/C8H5BrFN/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3H,4H2

SMILES: c1cc(CC#N)c(c(c1)Br)F

Synonyms:

• (3-Bromo-2-fluorophenyl)acetonitrile
• Benzeneacetonitrile, 3-Bromo-2-Fluoro-
• 3-Bromo-2-fluorophenylacetonitrile

3-Bromo-2-fluorophenylacetonitrile

CAS: 874285-03-7

Formula: C₈H₅BrFN

Purity: 95%

Color and Shape: Liquid

Molecular weight: 214.0344

Ref: IN-DA003BR8

3-Bromo-2-fluorophenylacetonitrile

CAS: 874285-03-7

3-Bromo-2-fluorophenylacetonitrile

Formula: C₈H₅BrFN

Purity: 98%

Color and Shape: white waxy fused solid

Molecular weight: 214.03g/mol

Ref: 54-PC1377

3-Bromo-2-fluorophenylacetonitrile

CAS: 874285-03-7

Formula: C₈H₅BrFN

Purity: 95%

Color and Shape: Liquid

Molecular weight: 214.037

Ref: 10-F217559