CymitQuimica logo

CAS 874285-15-1

:

3-Bromo-2-fluorobenzeneethanamine

Description:
3-Bromo-2-fluorobenzeneethanamine, with the CAS number 874285-15-1, is an organic compound characterized by the presence of both bromine and fluorine substituents on a benzene ring, along with an ethylamine functional group. This compound features a bromine atom at the 3-position and a fluorine atom at the 2-position of the benzene ring, which can influence its reactivity and physical properties. The presence of these halogens typically enhances the compound's electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The ethylamine group contributes to its basicity and potential for forming hydrogen bonds, which can affect its solubility in polar solvents. Additionally, the compound may exhibit interesting biological activity due to its structural features, making it of interest in medicinal chemistry. Overall, 3-Bromo-2-fluorobenzeneethanamine is a versatile compound with applications in synthetic organic chemistry and potentially in pharmaceuticals.
Formula:C8H9BrFN
InChI:InChI=1S/C8H9BrFN/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3H,4-5,11H2
InChI key:InChIKey=UJIFQRRRDGPAAG-UHFFFAOYSA-N
SMILES:C(CN)C1=C(F)C(Br)=CC=C1
Synonyms:
  • 2-(3-Bromo-2-fluorophenyl)ethanamine
  • 2-(3-Bromo-2-fluorophenyl)ethan-1-amine
  • Benzeneethanamine, 3-bromo-2-fluoro-
  • 3-Bromo-2-fluorobenzeneethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.