CAS 874288-10-5

[3-(3-chloropropylcarbamoyl)phenyl]boronic acid

Description:

[3-(3-chloropropylcarbamoyl)phenyl]boronic acid is an organic compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a 3-chloropropylcarbamoyl group, which introduces both a halogen and a carbonyl functionality, potentially enhancing its reactivity and biological activity. The presence of the boronic acid moiety allows for participation in Suzuki coupling reactions, making it valuable in the synthesis of complex organic molecules. Additionally, the chloropropyl group may impart specific pharmacological properties, influencing the compound's interaction with biological targets. Overall, this compound exemplifies the versatility of boronic acids in chemical synthesis and their potential applications in drug development and materials science.

Formula: C₁₀H₁₃BClNO₃

InChI: InChI=1/C10H13BClNO3/c12-5-2-6-13-10(14)8-3-1-4-9(7-8)11(15)16/h1,3-4,7,15-16H,2,5-6H2,(H,13,14)

SMILES: c1cc(cc(c1)B(O)O)C(=NCCCCl)O

N-(3-Chloropropyl) 3-boronobenzamide

CAS: 874288-10-5

Formula: C₁₀H₁₃BClNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 241.4791

Ref: IN-DA004MVP

3-(3-Chloropropylcarbamoyl)benzeneboronic acid

CAS: 874288-10-5

3-(3-Chloropropylcarbamoyl)benzeneboronic acid

Purity: 98%

Molecular weight: 241.48g/mol

Ref: 54-OR9539

(3-((3-Chloropropyl)carbamoyl)phenyl)boronic acid

CAS: 874288-10-5

Formula: C₁₀H₁₃BClNO₃

Purity: 98%

Molecular weight: 241.48

Ref: 10-F216103