CAS 874288-11-6

B-[3-[[(2-Thienylmethyl)amino]carbonyl]phenyl]boronic acid

Description:

B-[3-[[(2-Thienylmethyl)amino]carbonyl]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with a carbonyl group linked to a thienylmethylamino moiety, contributing to its potential biological activity. The thienyl group, derived from thiophene, introduces heteroatoms that can enhance the compound's interaction with biological targets. Boronic acids are often utilized in medicinal chemistry for their role in drug design, particularly in the development of protease inhibitors and in the synthesis of complex organic molecules through Suzuki coupling reactions. The presence of the amino and carbonyl groups suggests potential for hydrogen bonding and increased solubility in polar solvents. Overall, this compound's unique structure may confer specific reactivity and biological properties, making it of interest in pharmaceutical research and development.

Formula: C₁₂H₁₂BNO₃S

InChI: InChI=1S/C12H12BNO3S/c15-12(14-8-11-5-2-6-18-11)9-3-1-4-10(7-9)13(16)17/h1-7,16-17H,8H2,(H,14,15)

InChI key: InChIKey=RLAAJTUMWGIFSW-UHFFFAOYSA-N

SMILES: C(NCC1=CC=CS1)(=O)C2=CC(B(O)O)=CC=C2

Synonyms:

• B-[3-[[(2-Thienylmethyl)amino]carbonyl]phenyl]boronic acid
• Boronic acid, B-[3-[[(2-thienylmethyl)amino]carbonyl]phenyl]-
• Boronic acid, [3-[[(2-thienylmethyl)amino]carbonyl]phenyl]-