CAS 874288-13-8

B-[3-[(3-Pyridinylamino)carbonyl]phenyl]boronic acid

Description:

B-[3-[(3-Pyridinylamino)carbonyl]phenyl]boronic acid, with the CAS number 874288-13-8, is a boronic acid derivative characterized by its boron atom bonded to a phenyl group and an amino-substituted pyridine moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and organic synthesis. The presence of the pyridinylamino group suggests potential biological activity, as pyridine derivatives are often involved in drug design due to their ability to interact with biological targets. Additionally, the carboxylic acid functionality contributes to its solubility in polar solvents and may influence its reactivity and interaction with other molecules. Overall, this compound's unique structure positions it as a valuable tool in research and development, particularly in the fields of pharmaceuticals and materials science.

Formula: C₁₂H₁₁BN₂O₃

InChI: InChI=1S/C12H11BN2O3/c16-12(15-11-5-2-6-14-8-11)9-3-1-4-10(7-9)13(17)18/h1-8,17-18H,(H,15,16)

InChI key: InChIKey=VRBGVGVQKHVOFT-UHFFFAOYSA-N

SMILES: C(NC=1C=CC=NC1)(=O)C2=CC(B(O)O)=CC=C2

Synonyms:

• Boronic acid, [3-[(3-pyridinylamino)carbonyl]phenyl]-
• B-[3-[(3-Pyridinylamino)carbonyl]phenyl]boronic acid
• Boronic acid, B-[3-[(3-pyridinylamino)carbonyl]phenyl]-