CAS 874288-28-5

B-[3-[[(4-Bromophenyl)amino]carbonyl]phenyl]boronic acid

Description:

B-[3-[[(4-Bromophenyl)amino]carbonyl]phenyl]boronic acid, with the CAS number 874288-28-5, is a boronic acid derivative characterized by its unique molecular structure that includes a boron atom bonded to a phenyl group and an amide functional group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the bromophenyl group may enhance its reactivity and solubility in organic solvents. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in complex organic molecules. The compound's specific characteristics, such as melting point, solubility, and reactivity, can vary based on its purity and the conditions under which it is handled. Overall, this compound represents a valuable tool in the development of pharmaceuticals and advanced materials.

Formula: C₁₃H₁₁BBrNO₃

InChI: InChI=1S/C13H11BBrNO3/c15-11-4-6-12(7-5-11)16-13(17)9-2-1-3-10(8-9)14(18)19/h1-8,18-19H,(H,16,17)

InChI key: InChIKey=JTIUHKZUVGVPGO-UHFFFAOYSA-N

SMILES: C(NC1=CC=C(Br)C=C1)(=O)C2=CC(B(O)O)=CC=C2

Synonyms:

• Boronic acid, B-[3-[[(4-bromophenyl)amino]carbonyl]phenyl]-
• Boronic acid, [3-[[(4-bromophenyl)amino]carbonyl]phenyl]-
• B-[3-[[(4-Bromophenyl)amino]carbonyl]phenyl]boronic acid

3-(4-Bromophenylcarbamoyl)phenylboronic acid

CAS: 874288-28-5

Formula: C₁₃H₁₁BBrNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 319.9463

Ref: IN-DA003I3R

3-[(4-Bromophenyl)carbamoyl]benzeneboronic acid

CAS: 874288-28-5

3-[(4-Bromophenyl)carbamoyl]benzeneboronic acid

Purity: 95%

Molecular weight: 319.95g/mol

Ref: 54-OR11448

(3-((4-Bromophenyl)carbamoyl)phenyl)boronic acid

CAS: 874288-28-5

Purity: 98%

Molecular weight: 319.9500122

Ref: 10-F694033