CAS 874289-23-3

B-[2-Fluoro-4-[(methylamino)carbonyl]phenyl]boronic acid

Description:

B-[2-Fluoro-4-[(methylamino)carbonyl]phenyl]boronic acid, with the CAS number 874289-23-3, is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a fluorinated phenyl ring, which enhances its reactivity and solubility in various organic solvents. The methylamino group contributes to its potential as a building block in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The boronic acid moiety is particularly valuable in Suzuki coupling reactions, making it useful in the synthesis of complex organic molecules. Additionally, the presence of the fluorine atom can influence the electronic properties of the molecule, potentially affecting its biological activity and pharmacokinetics. Overall, this compound exemplifies the versatility of boronic acids in organic synthesis and drug development.

Formula: C₈H₉BFNO₃

InChI: InChI=1S/C8H9BFNO3/c1-11-8(12)5-2-3-6(9(13)14)7(10)4-5/h2-4,13-14H,1H3,(H,11,12)

InChI key: InChIKey=STYRVOIKGOQNAD-UHFFFAOYSA-N

SMILES: C(NC)(=O)C1=CC(F)=C(B(O)O)C=C1

Synonyms:

• Boronic acid, B-[2-fluoro-4-[(methylamino)carbonyl]phenyl]-
• (2-Fluoro-4-(methylcarbamoyl)phenyl)boronic acid
• Boronic acid, [2-fluoro-4-[(methylamino)carbonyl]phenyl]-
• B-[2-Fluoro-4-[(methylamino)carbonyl]phenyl]boronic acid

[2-Fluoro-4-(methylcarbamoyl)phenyl]boronic acid

CAS: 874289-23-3

Formula: C₈H₉BFNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 196.9714

Ref: IN-DA00IEIW

(2-Fluoro-4-(methylcarbamoyl)phenyl)boronic acid

CAS: 874289-23-3

(2-Fluoro-4-(methylcarbamoyl)phenyl)boronic acid

Purity: 98%

Molecular weight: 196.97g/mol

Ref: 54-PC110352

(2-Fluoro-4-(methylcarbamoyl)phenyl)boronic acid

CAS: 874289-23-3

Purity: 98%

Molecular weight: 196.9700012

Ref: 10-F691476