CAS 874289-29-9

B-[4-[(Ethylamino)carbonyl]-2-fluorophenyl]boronic acid

Description:

B-[4-[(Ethylamino)carbonyl]-2-fluorophenyl]boronic acid, with the CAS number 874289-29-9, is a boronic acid derivative characterized by its boron atom bonded to a phenyl group that contains a fluorine substituent and an ethylamino carbonyl moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its biological activity. Additionally, the ethylamino carbonyl group may contribute to its solubility and reactivity. Boronic acids are often utilized in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. Overall, this compound's unique structure and functional groups suggest potential utility in pharmaceutical development and materials science, particularly in the design of targeted therapies or as intermediates in complex organic syntheses.

Formula: C₉H₁₁BFNO₃

InChI: InChI=1S/C9H11BFNO3/c1-2-12-9(13)6-3-4-7(10(14)15)8(11)5-6/h3-5,14-15H,2H2,1H3,(H,12,13)

InChI key: InChIKey=RVPOYQNEOOWSAW-UHFFFAOYSA-N

SMILES: C(NCC)(=O)C1=CC(F)=C(B(O)O)C=C1

Synonyms:

• Boronic acid, B-[4-[(ethylamino)carbonyl]-2-fluorophenyl]-
• Boronic acid, [4-[(ethylamino)carbonyl]-2-fluorophenyl]-
• B-[4-[(Ethylamino)carbonyl]-2-fluorophenyl]boronic acid

4-(ethylcarbamoyl)-2-fluorophenylboronic acid

CAS: 874289-29-9

Formula: C₉H₁₁BFNO₃

Purity: 95%

Molecular weight: 210.9979

Ref: IN-DA00IEIZ

2-Fluoro-4-(N-ethylaminocarbonyl)phenylboronic acid

CAS: 874289-29-9

Purity: ≥95%

Molecular weight: 211

Ref: 10-F628023