CAS 874289-39-1
:5-Carbamoyl-2-fluorobenzeneboronic acid
Description:
5-Carbamoyl-2-fluorobenzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. The compound features a fluorine atom substituted at the 2-position of the benzene ring, which can influence its electronic properties and reactivity. The carbamoyl group at the 5-position contributes to its potential as a building block in drug development and materials science. This compound is typically a solid at room temperature and is soluble in polar solvents, making it suitable for various chemical reactions. Its boronic acid functionality allows it to participate in Suzuki coupling reactions, which are essential for forming carbon-carbon bonds in complex organic molecules. Additionally, the presence of the fluorine atom may enhance its biological activity or selectivity in pharmaceutical applications. Overall, 5-Carbamoyl-2-fluorobenzeneboronic acid is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C7H7BFNO3
InChI:InChI=1/C7H7BFNO3/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,12-13H,(H2,10,11)
SMILES:c1cc(c(cc1C(=N)O)B(O)O)F
Synonyms:- 3-Borono-4-fluorobenzamide
- (5-Carbamoyl-2-Fluoro-Phenyl)Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Carbamoyl-2-fluorobenzeneboronic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H7BFNO3Purity:95%Molecular weight:182.953-Borono-4-fluorobenzamide
CAS:Formula:C7H7BFNO3Purity:98%Color and Shape:SolidMolecular weight:182.94485-Carbamoyl-2-fluorobenzeneboronic acid
CAS:5-Carbamoyl-2-fluorobenzeneboronic acidFormula:C7H7BFNO3Purity:97%Color and Shape:White PowderMolecular weight:182.94g/mol(5-Carbamoyl-2-fluorophenyl)boronic acid
CAS:Formula:C7H7BFNO3Purity:98%Color and Shape:Solid, White solidMolecular weight:182.95



