CAS 874289-59-5

B-[2-Fluoro-5-[(methoxymethylamino)carbonyl]phenyl]boronic acid

Description:

B-[2-Fluoro-5-[(methoxymethylamino)carbonyl]phenyl]boronic acid, with the CAS number 874289-59-5, is a boronic acid derivative characterized by its unique functional groups that contribute to its chemical reactivity and potential applications. This compound features a boron atom bonded to a phenyl ring that is substituted with a fluorine atom and a methoxymethylamino carbonyl group. The presence of the boronic acid functional group allows for reversible covalent bonding with diols, making it useful in various applications, including medicinal chemistry and materials science. The fluorine substitution can enhance the compound's lipophilicity and biological activity. Additionally, the methoxymethylamino carbonyl moiety may influence its solubility and interaction with biological targets. Overall, this compound's structural characteristics suggest potential utility in drug development, particularly in the design of inhibitors or modulators of biological pathways. Its reactivity and functional versatility make it a subject of interest in synthetic and medicinal chemistry.

Formula: C₉H₁₁BFNO₄

InChI: InChI=1/C9H11BFNO4/c1-12(16-2)9(13)6-3-4-8(11)7(5-6)10(14)15/h3-5,14-15H,1-2H3

InChI key: InChIKey=UIALQZJYMDELNI-UHFFFAOYSA-N

SMILES: C(N(OC)C)(=O)C1=CC(B(O)O)=C(F)C=C1

Synonyms:

• Boronic acid, [2-fluoro-5-[(methoxymethylamino)carbonyl]phenyl]-
• Boronic acid, B-[2-fluoro-5-[(methoxymethylamino)carbonyl]phenyl]-
• B-[2-Fluoro-5-[(methoxymethylamino)carbonyl]phenyl]boronic acid

N-Methoxy-N-methyl 3-borono-4-fluorobenzamide

CAS: 874289-59-5

Formula: C₉H₁₁BFNO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 226.9973

Ref: IN-DA004FYU

2-Fluoro-5-(N-methoxy-N-methylcarbamoyl)benzeneboronic acid

CAS: 874289-59-5

2-Fluoro-5-(N-methoxy-N-methylcarbamoyl)benzeneboronic acid

Purity: 98%

Molecular weight: 227.00g/mol

Ref: 54-PC3588

(2-Fluoro-5-(methoxy(methyl)carbamoyl)phenyl)boronic acid

CAS: 874289-59-5

Purity: 98%

Molecular weight: 227

Ref: 10-F694276