CymitQuimica logo

CAS 874289-60-8

:

B-[2-Fluoro-4-[(methoxyamino)carbonyl]phenyl]boronic acid

Description:
B-[2-Fluoro-4-[(methoxyamino)carbonyl]phenyl]boronic acid, with the CAS number 874289-60-8, is a boronic acid derivative characterized by its unique functional groups that include a fluorine atom and a methoxyamino carbonyl moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its biological activity. Additionally, the methoxyamino group may contribute to its solubility and reactivity. The compound is likely to be a solid at room temperature and may be sensitive to moisture, requiring careful handling and storage. Its specific applications may include use as a building block in drug development or as a reagent in chemical reactions, particularly in the synthesis of complex organic molecules. Overall, this compound represents a versatile tool in the field of chemistry, particularly in the development of pharmaceuticals.
Formula:C8H9BFNO4
InChI:InChI=1S/C8H9BFNO4/c1-15-11-8(12)5-2-3-6(9(13)14)7(10)4-5/h2-4,13-14H,1H3,(H,11,12)
InChI key:InChIKey=ZLWDTVKNRUIREM-UHFFFAOYSA-N
SMILES:C(NOC)(=O)C1=CC(F)=C(B(O)O)C=C1
Synonyms:
  • Boronic acid, B-[2-fluoro-4-[(methoxyamino)carbonyl]phenyl]-
  • B-[2-Fluoro-4-[(methoxyamino)carbonyl]phenyl]boronic acid
  • Boronic acid, [2-fluoro-4-[(methoxyamino)carbonyl]phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.