CAS 87429-91-2
:4-{2-[4-(diphenylmethyl)piperazin-1-yl]-1-hydroxyethyl}phenol hydrochloride
Description:
4-{2-[4-(Diphenylmethyl)piperazin-1-yl]-1-hydroxyethyl}phenol hydrochloride, with the CAS number 87429-91-2, is a chemical compound characterized by its complex structure, which includes a phenolic group, a piperazine moiety, and a diphenylmethyl substituent. This compound typically appears as a white to off-white crystalline powder and is soluble in water and various organic solvents, which is indicative of its polar functional groups. The presence of the piperazine ring suggests potential pharmacological activity, as piperazine derivatives are often associated with various biological effects, including antipsychotic and antidepressant properties. The hydrochloride salt form enhances its stability and solubility, making it suitable for pharmaceutical applications. Its molecular structure allows for interactions with biological targets, which may contribute to its therapeutic potential. However, specific biological activities, safety profiles, and applications would require further investigation through empirical studies and clinical trials.
Formula:C25H29ClN2O2
InChI:InChI=1/C25H28N2O2.ClH/c28-23-13-11-20(12-14-23)24(29)19-26-15-17-27(18-16-26)25(21-7-3-1-4-8-21)22-9-5-2-6-10-22;/h1-14,24-25,28-29H,15-19H2;1H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-[2-(4-benzhydrylpiperazin-1-yl)-1-hydroxy-ethyl]phenol hydrochloride
CAS:Formula:C25H29ClN2O2Molecular weight:424.963
