CymitQuimica logo

CAS 874290-65-0

:

B-(2-Chloro-4-cyano-3-pyridinyl)boronic acid

Description:
B-(2-Chloro-4-cyano-3-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that is substituted with a chloro and a cyano group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of the chloro and cyano groups can influence its reactivity and biological activity, potentially enhancing its role as a pharmaceutical intermediate or in agrochemical applications. Additionally, the compound may exhibit specific spectral characteristics in NMR and IR spectroscopy due to the functional groups present. Overall, B-(2-Chloro-4-cyano-3-pyridinyl)boronic acid is a versatile compound with significant utility in synthetic chemistry and potential applications in drug development.
Formula:C6H4BClN2O2
InChI:InChI=1S/C6H4BClN2O2/c8-6-5(7(11)12)4(3-9)1-2-10-6/h1-2,11-12H
InChI key:InChIKey=RRDKKHSTFCRAGS-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C(C#N)=CC=NC1Cl
Synonyms:
  • Boronic acid, B-(2-chloro-4-cyano-3-pyridinyl)-
  • B-(2-Chloro-4-cyano-3-pyridinyl)boronic acid
  • Boronic acid, (2-chloro-4-cyano-3-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.