CAS 874298-21-2

1-[(4-methoxyphenyl)methyl]-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea

Description:

1-[(4-methoxyphenyl)methyl]-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea, with CAS number 874298-21-2, is a synthetic organic compound characterized by its urea functional group, which is linked to two distinct aromatic moieties. The presence of a methoxy group on one of the phenyl rings enhances its solubility and reactivity, while the boron-containing dioxaborolane moiety contributes to its potential applications in medicinal chemistry and materials science. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in drug development or as a chemical probe. Its molecular structure suggests potential interactions with biological targets, and the boron atom may facilitate unique reactivity patterns. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the aromatic rings, which can affect its overall properties and applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₂₁H₂₇BN₂O₄

InChI: InChI=1/C21H27BN2O4/c1-20(2)21(3,4)28-22(27-20)16-8-10-17(11-9-16)24-19(25)23-14-15-6-12-18(26-5)13-7-15/h6-13H,14H2,1-5H3,(H2,23,24,25)

SMILES: CC1(C)C(C)(C)OB(c2ccc(cc2)NC(=NCc2ccc(cc2)OC)O)O1

1-(4-Methoxybenzyl)-3-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea

CAS: 874298-21-2

Formula: C₂₁H₂₇BN₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 382.2611

Ref: IN-DA004MGO

4-{[(4-Methoxybenzyl)carbamoyl]amino}benzeneboronic acid, pinacol ester

CAS: 874298-21-2

4-{[(4-Methoxybenzyl)carbamoyl]amino}benzeneboronic acid, pinacol ester

Purity: 98%

Molecular weight: 382.26g/mol

Ref: 54-OR3258

1-(4-Methoxybenzyl)-3-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea

CAS: 874298-21-2

Formula: C₂₁H₂₇BN₂O₄

Purity: 98%

Molecular weight: 382.27

Ref: 10-F217371