CymitQuimica logo

CAS 874338-84-8

:

3-Pyridazinamine, 6-(2-phenylethyl)-

Description:
3-Pyridazinamine, 6-(2-phenylethyl)- is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 2. This compound features an amino group (-NH2) at the 3-position and a phenylethyl substituent at the 6-position, contributing to its unique properties. The presence of the phenylethyl group enhances its lipophilicity, potentially influencing its biological activity and interaction with various receptors or enzymes. The molecular structure suggests that it may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. However, specific data regarding its solubility, stability, and reactivity would require further investigation through experimental studies or literature review.
Formula:C12H13N3
InChI:InChI=1/C12H13N3/c13-12-9-8-11(14-15-12)7-6-10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H2,13,15)
Synonyms:
  • 6-(2-Phenylethyl)-3-pyridazinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.