CAS 874338-91-7

6-[(3-Methoxyphenyl)methyl]-3-pyridazinamine

Description:

6-[(3-Methoxyphenyl)methyl]-3-pyridazinamine, identified by its CAS number 874338-91-7, is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features a methoxy-substituted phenyl group attached to a methyl group, contributing to its overall structure and potentially influencing its biological activity. The presence of the pyridazinamine moiety suggests that it may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. The methoxy group can enhance lipophilicity, potentially affecting the compound's solubility and permeability in biological systems. This compound may be of interest in medicinal chemistry due to its structural features, which could be associated with various pharmacological activities. However, specific biological activities, toxicity, and applications would require further investigation through experimental studies and literature review. As with any chemical substance, proper handling and safety measures should be observed due to potential hazards associated with its use.

Formula: C₁₂H₁₃N₃O

InChI: InChI=1S/C12H13N3O/c1-16-11-4-2-3-9(8-11)7-10-5-6-12(13)15-14-10/h2-6,8H,7H2,1H3,(H2,13,15)

InChI key: InChIKey=IFLQAQFBHXXGTG-UHFFFAOYSA-N

SMILES: C(C1=CC(OC)=CC=C1)C2=CC=C(N)N=N2

Synonyms:

• 6-[(3-Methoxyphenyl)methyl]-3-pyridazinamine
• 3-Pyridazinamine, 6-[(3-methoxyphenyl)methyl]-