CymitQuimica logo

CAS 874338-92-8

:

3-[(6-Amino-3-pyridazinyl)methyl]benzonitrile

Description:
3-[(6-Amino-3-pyridazinyl)methyl]benzonitrile, with the CAS number 874338-92-8, is a chemical compound characterized by its unique structure, which includes a benzonitrile moiety and a pyridazine ring substituted with an amino group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the nitrile and amino functional groups. The amino group can participate in hydrogen bonding, influencing its solubility and interaction with biological targets. The presence of the pyridazine ring may also impart specific electronic properties, making it of interest in medicinal chemistry and drug design. Additionally, compounds like this may exhibit biological activity, potentially serving as intermediates in the synthesis of pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally, as they can vary based on environmental conditions and purity.
Formula:C12H10N4
InChI:InChI=1/C12H10N4/c13-8-10-3-1-2-9(6-10)7-11-4-5-12(14)16-15-11/h1-6H,7H2,(H2,14,16)
InChI key:InChIKey=JFQPJXJTVICMEL-UHFFFAOYSA-N
SMILES:C(C1=CC(C#N)=CC=C1)C2=CC=C(N)N=N2
Synonyms:
  • 3-[(6-Amino-3-pyridazinyl)methyl]benzonitrile
  • Benzonitrile, 3-[(6-amino-3-pyridazinyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.