CAS 87434-82-0
:6-amino-1,5-dihydro-4H-imidazo[4,5-c]pyridin-4-one methanesulfonate (1:1)
Description:
6-amino-1,5-dihydro-4H-imidazo[4,5-c]pyridin-4-one methanesulfonate (1:1), with CAS number 87434-82-0, is a chemical compound characterized by its imidazopyridine structure, which features a fused ring system that includes both imidazole and pyridine components. This compound typically exhibits properties such as solubility in polar solvents, which is influenced by the presence of the methanesulfonate group, enhancing its ionic character. The amino group contributes to its potential as a base, while the methanesulfonate moiety can act as a counterion, affecting its overall stability and reactivity. This compound may be of interest in medicinal chemistry due to its structural features that could interact with biological targets. Additionally, its unique heterocyclic structure may impart specific pharmacological properties, making it a candidate for further research in drug development. As with many organic compounds, its behavior in various chemical environments can be influenced by factors such as pH, temperature, and the presence of other reactive species.
Formula:C7H10N4O4S
InChI:InChI=1/C6H6N4O.CH4O3S/c7-4-1-3-5(6(11)10-4)9-2-8-3;1-5(2,3)4/h1-2H,(H,8,9)(H3,7,10,11);1H3,(H,2,3,4)
Synonyms:- PD 90695-73
- 6-Amino-1,5-dihydro-4H-imidazo[4,5-c]pyridin-4-one Monomethanesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4H-Imidazo[4,5-c]pyridin-4-one, 6-amino-3,5-dihydro-, methanesulfonate (1:1)
CAS:Formula:C7H10N4O4SMolecular weight:246.2437
