CAS 874374-25-1
:1H-Pyrido[3,4-b]indole-3-carboxylic acid,1-[3-[[4-(2-fluorophenyl)-1-piperazinyl]methyl]-4-methoxyphenyl]-2,3,4,9-tetrahydro-
Description:
1H-Pyrido[3,4-b]indole-3-carboxylic acid, with the CAS number 874374-25-1, is a complex organic compound characterized by its bicyclic structure that incorporates both pyridine and indole moieties. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. Additionally, it contains a piperazine ring substituted with a 2-fluorophenyl group and a methoxyphenyl group, indicating its potential for diverse interactions in biological systems. The presence of these functional groups suggests that the compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its structural complexity may also influence its solubility, stability, and bioavailability. Overall, this compound represents a unique scaffold that could be explored for various applications, particularly in drug development, due to its potential interactions with biological targets. Further studies would be necessary to elucidate its specific properties and potential therapeutic uses.
Formula:C30H31FN4O3
InChI:InChI=1S/C30H31FN4O3/c1-38-27-11-10-19(16-20(27)18-34-12-14-35(15-13-34)26-9-5-3-7-23(26)31)28-29-22(17-25(33-28)30(36)37)21-6-2-4-8-24(21)32-29/h2-11,16,25,28,32-33H,12-15,17-18H2,1H3,(H,36,37)
InChI key:FUHCEERDBRGPQZ-UHFFFAOYSA-N
SMILES:COC1=C(C=C(C=C1)C2C3=C(CC(N2)C(=O)O)C4=CC=CC=C4N3)CN5CCN(CC5)C6=CC=CC=C6F
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-(3-((4-(2-Fluorophenyl)piperazin-1-yl)methyl)-4-methoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid
CAS:Formula:C30H31FN4O3Purity:98%Color and Shape:SolidMolecular weight:514.5905Ned 19
CAS:Ned 19 inhibits tumor growth, vascularization, lung metastases in mice, and is a selective NAADP antagonist.Formula:C30H31FN4O3Purity:99.66%Color and Shape:White SolidMolecular weight:514.59Ref: TM-T12205
1mg60.00€2mg87.00€5mg130.00€1mL*10mM (DMSO)146.00€10mg192.00€25mg324.00€50mg480.00€100mg683.00€500mg1,378.00€Ned 19
CAS:Ned 19 is a sophisticated neuromodulation system, derived from advanced optogenetic technology, with a unique capability to precisely control and modulate neuronal activity. This system utilizes a refined approach based on light-sensitive proteins to influence neural circuits with high specificity and temporal precision. This mode of action allows researchers to manipulate targeted neurons with unparalleled accuracy, facilitating the dissection of complex neural networks and behaviors.Formula:C30H31FN4O3Purity:Min. 95%Molecular weight:514.6 g/molRef: 3D-ZJB37425
Discontinued product




