CAS 874375-17-4

4-bromo-7-methyl-indoline-2,3-dione

Description:

4-Bromo-7-methyl-indoline-2,3-dione, with the CAS number 874375-17-4, is a synthetic organic compound characterized by its indoline structure, which features a bromine atom and a methyl group as substituents. This compound typically exhibits a solid state at room temperature and is known for its potential applications in various fields, including organic synthesis and medicinal chemistry. The presence of the bromine atom can impart unique reactivity, making it useful in further chemical transformations. The indoline-2,3-dione moiety suggests that it may exhibit interesting electronic properties, potentially making it a candidate for use in dyes or pigments. Additionally, the compound may show biological activity, which warrants investigation for pharmaceutical applications. Its solubility and stability can vary depending on the solvent and conditions, and it is essential to handle it with care, following appropriate safety protocols due to the presence of halogenated compounds. Overall, 4-bromo-7-methyl-indoline-2,3-dione represents a versatile building block in organic chemistry.

Formula: C₉H₆BrNO₂

InChI: InChI=1/C9H6BrNO2/c1-4-2-3-5(10)6-7(4)11-9(13)8(6)12/h2-3H,1H3,(H,11,12,13)

SMILES: Cc1ccc(c2c1NC(=O)C2=O)Br

Synonyms:

• 1H-Indole-2,3-dione, 4-bromo-7-methyl-
• 4-Brom-7-methyl-1H-indol-2,3-dion
• 4-Bromo-7-methyl-1H-indole-2,3-dione
• 4-Bromo-7-methylisatin

4-bromo-7-methyl-2,3-dihydro-1H-indole-2,3-dione

CAS: 874375-17-4

Formula: C₉H₆BrNO₂

Purity: %

Color and Shape: Solid

Molecular weight: 240.0534

Ref: IN-DA008DFS

4-Bromo-7-methylisatin

CAS: 874375-17-4

4-Bromo-7-methylisatin

Purity: 98%

Molecular weight: 240.05g/mol

Ref: 54-OR30468

4-Bromo-7-methylisatin

CAS: 874375-17-4

4-Bromo-7-methylisatin is a chemical compound that is used as a reagent, reaction component, and building block in organic chemistry. 4-Bromo-7-methylisatin is an important intermediate for the synthesis of other compounds and has been shown to have versatile applications in the synthesis of complex compounds. It has also been used as a speciality chemical in research applications and as a fine chemical.

Formula: C₉H₆BrNO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 240.05 g/mol

Ref: 3D-FB70026