CAS 87440-56-0

(2R,3R)-2,3-Dihydro-3,5,7-trihydroxy-8-(3-methyl-2-buten-1-yl)-2-phenyl-4H-1-benzopyran-4-one

Description:

The chemical substance known as (2R,3R)-2,3-Dihydro-3,5,7-trihydroxy-8-(3-methyl-2-buten-1-yl)-2-phenyl-4H-1-benzopyran-4-one, with the CAS number 87440-56-0, is a flavonoid compound characterized by its complex polyphenolic structure. This compound features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of a phenyl group and a substituted isoprenyl moiety enhances its biological activity, making it of interest in various fields, including pharmacology and natural product chemistry. Its stereochemistry, indicated by the (2R,3R) configuration, suggests specific spatial arrangements that may influence its interactions with biological targets. The compound is likely to exhibit solubility in organic solvents and may have limited solubility in water due to its hydrophobic regions. Overall, this flavonoid's unique structure and functional groups may confer various health benefits, including anti-inflammatory and anticancer properties, although further research is necessary to fully elucidate its biological effects and potential applications.

Formula: C₂₀H₂₀O₅

InChI: InChI=1S/C20H20O5/c1-11(2)8-9-13-14(21)10-15(22)16-17(23)18(24)19(25-20(13)16)12-6-4-3-5-7-12/h3-8,10,18-19,21-22,24H,9H2,1-2H3/t18-,19+/m0/s1

InChI key: InChIKey=ATJOIGKHVRPLSM-RBUKOAKNSA-N

SMILES: C(C=C(C)C)C1=C2C(C(=O)[C@H](O)[C@H](O2)C3=CC=CC=C3)=C(O)C=C1O

Synonyms:

• 4H-1-Benzopyran-4-one, 2,3-dihydro-3,5,7-trihydroxy-8-(3-methyl-2-butenyl)-2-phenyl-, (2R,3R)-
• (2R,3R)-2,3-Dihydro-3,5,7-trihydroxy-8-(3-methyl-2-buten-1-yl)-2-phenyl-4H-1-benzopyran-4-one
• Glepidotin B
• 4H-1-Benzopyran-4-one, 2,3-dihydro-3,5,7-trihydroxy-6-(3-methyl-2-butenyl)-2-phenyl-, (2R-trans)-
• 4H-1-Benzopyran-4-one, 2,3-dihydro-3,5,7-trihydroxy-8-(3-methyl-2-buten-1-yl)-2-phenyl-, (2R,3R)-

(2R,3R)-3,5,7-trihydroxy-8-(3-methylbut-2-enyl)-2-phenyl-chroman-4-one

CAS: 87440-56-0

Formula: C₂₀H₂₀O₅

Purity: 95%

Molecular weight: 340.3698

Ref: IN-DA004MD3

Glepidotin B

CAS: 87440-56-0

Glepidotin B is a natural product of Glycyrrhiza, Fabaceae.

Formula: C₂₀H₂₀O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 340.37

Ref: TM-TN4136

Glepidotin B

CAS: 87440-56-0

Formula: C₂₀H₂₀O₅

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 340.375

Ref: BP-SBP02673

Glepidotin B

CAS: 87440-56-0

Glepidotin B is a naturally occurring flavonoid compound, which is derived from certain plant species known for their medicinal properties. This compound operates through a mode of action which involves the inhibition of specific cellular pathways that contribute to the proliferation of cancer cells. The precise mechanism is linked to its ability to interfere with cellular signaling processes, thereby inducing apoptosis or programmed cell death in malignant cells.

Formula: C₂₀H₂₀O₅

Purity: Min. 95%

Molecular weight: 340.4 g/mol

Ref: 3D-MDA44056