CAS 87440-88-8
:2-Bromomethyl-3-hydroxypyridine hydrobromide
Description:
2-Bromomethyl-3-hydroxypyridine hydrobromide is a chemical compound characterized by its pyridine ring structure, which includes a bromomethyl group and a hydroxyl group at specific positions. This compound is typically a white to off-white solid and is soluble in water and various organic solvents, owing to the presence of the hydrobromide salt form. The presence of the bromomethyl group suggests potential reactivity, making it useful in organic synthesis, particularly in the formation of carbon-carbon bonds or as an intermediate in the synthesis of other compounds. The hydroxyl group contributes to its polarity and can participate in hydrogen bonding, influencing its solubility and reactivity. As with many brominated compounds, it may exhibit biological activity, which could be of interest in medicinal chemistry. Safety data should be consulted, as brominated compounds can pose health risks, and appropriate handling procedures should be followed. Overall, 2-Bromomethyl-3-hydroxypyridine hydrobromide is a versatile compound with applications in various fields of chemistry.
Formula:C6H7Br2NO
InChI:InChI=1/C6H6BrNO.BrH/c7-4-5-6(9)2-1-3-8-5;/h1-3,9H,4H2;1H
SMILES:c1cc(c(CBr)nc1)O.Br
Synonyms:- 2-(Bromomethyl)pyridin-3-ol hydrobromide (1:1)
- 2-Bromomethyl-3-hydroxypyridinehydrobromide
- 3-Pyridinol, 2-(Bromomethyl)-, Hydrobromide (1:1)
- 2-(Bromomethyl)Pyridin-3-Ol Hydrobromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
