CAS 87441-73-4

1a,7a-dimethyl-5-methylidenedecahydrobisoxireno[4,5:8,9]cyclodeca[1,2-b]furan-4(1aH)-one

Description:

1a,7a-dimethyl-5-methylidenedecahydrobisoxireno[4,5:8,9]cyclodeca[1,2-b]furan-4(1aH)-one, with CAS number 87441-73-4, is a complex organic compound characterized by its unique bicyclic structure that incorporates multiple fused rings and functional groups. This compound features a combination of oxirane (epoxide) and furan moieties, contributing to its potential reactivity and stability. The presence of multiple methyl groups indicates a degree of branching, which can influence its physical properties, such as boiling point and solubility. The compound's structure suggests it may exhibit interesting chemical behavior, including potential applications in organic synthesis or as a precursor in the development of more complex molecules. Additionally, the stereochemistry associated with the multiple chiral centers may lead to distinct isomers, each with unique properties. Overall, this compound represents a fascinating example of synthetic organic chemistry, with potential implications in various fields, including materials science and medicinal chemistry.

Formula: C₁₅H₂₀O₄

InChI: InChI=1/C15H20O4/c1-8-9-6-12-14(2,19-12)5-4-11-15(3,18-11)7-10(9)17-13(8)16/h9-12H,1,4-7H2,2-3H3

SMILES: C=C1C2CC3C(C)(CCC4C(C)(CC2OC1=O)O4)O3

Synonyms:

• 11(13)-Dehydroivaxillin

11(13)-Dehydroivaxillin

CAS: 87441-73-4

Formula: C₁₅H₂₀O₄

Purity: 97.5%

Molecular weight: 264.3169

Ref: IN-DA00H0F8

11(13)-Dehydroivaxillin

CAS: 87441-73-4

Formula: C₁₅H₂₀O₄

Purity: 95%~99%

Molecular weight: 264.321

Ref: BP-SBP00019

11(13)-Dehydroivaxillin

CAS: 87441-73-4

11(13)-Dehydroivaxillin is an antibacterial compound that is a naturally-derived compound isolated primarily from natural sources, such as medicinal plants. It functions by disrupting the cellular processes of bacteria, thereby inhibiting their growth and proliferation.

Formula: C₁₅H₂₀O₄

Purity: Min. 95%

Molecular weight: 264.32 g/mol

Ref: 3D-MDA44173