CymitQuimica logo

CAS 87443-96-7

:

N-(3-{[(4-bromophenyl)amino]methyl}-3-chloro-2-oxo-4-phenylazetidin-1-yl)-2-hydroxybenzamide

Description:
N-(3-{[(4-bromophenyl)amino]methyl}-3-chloro-2-oxo-4-phenylazetidin-1-yl)-2-hydroxybenzamide, with the CAS number 87443-96-7, is a complex organic compound characterized by its multi-functional structure. It features an azetidine ring, which is a four-membered cyclic amine, contributing to its potential biological activity. The presence of a bromophenyl group suggests that it may exhibit significant electronic properties, potentially influencing its reactivity and interactions with biological targets. The compound also contains a hydroxybenzamide moiety, which can enhance solubility and may play a role in hydrogen bonding interactions. Additionally, the chloro and oxo substituents introduce further diversity in its chemical behavior. Overall, this compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, given its structural complexity and the presence of various functional groups that can interact with biological systems. However, specific properties such as solubility, melting point, and biological activity would require empirical investigation for a comprehensive understanding.
Formula:C23H19BrClN3O3
InChI:InChI=1/C23H19BrClN3O3/c24-16-10-12-17(13-11-16)26-14-23(25)20(15-6-2-1-3-7-15)28(22(23)31)27-21(30)18-8-4-5-9-19(18)29/h1-13,20,26,29H,14H2,(H,27,30)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.