CymitQuimica logo

CAS 87444-41-5

:

6-Bromo-2-methylthiazolo[4,5-b]pyrazine

Description:
6-Bromo-2-methylthiazolo[4,5-b]pyrazine is a heterocyclic compound characterized by its unique structural features, which include a thiazole and pyrazine ring system. This compound typically exhibits a pale to dark yellow crystalline appearance. The presence of the bromine atom and the methyl group contributes to its reactivity and potential applications in various chemical reactions. It is known for its biological activity, making it of interest in medicinal chemistry and drug development. The compound may exhibit properties such as antimicrobial or antifungal activity, although specific biological effects can vary based on the context of use. Additionally, its solubility characteristics can vary, often being soluble in organic solvents while having limited solubility in water. The compound's stability and reactivity can be influenced by the presence of the bromine substituent, which can participate in nucleophilic substitution reactions. Overall, 6-Bromo-2-methylthiazolo[4,5-b]pyrazine is a compound of interest in both synthetic and applied chemistry fields.
Formula:C6H4BrN3S
InChI:InChI=1S/C6H4BrN3S/c1-3-9-5-6(11-3)10-4(7)2-8-5/h2H,1H3
InChI key:InChIKey=CYGQNATXHJNJTD-UHFFFAOYSA-N
SMILES:CC1=NC=2C(S1)=NC(Br)=CN2
Synonyms:
  • Thiazolo[4,5-b]pyrazine, 6-bromo-2-methyl-
  • 6-Bromo-2-methylthiazolo[4,5-b]pyrazine
  • 6-Bromo-2-methyl-[1,3]thiazolo[4,5-b]pyrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.