CAS 874440-86-5

Ethyl 4-ethyl-4-piperidinecarboxylate

Description:

Ethyl 4-ethyl-4-piperidinecarboxylate, identified by its CAS number 874440-86-5, is a chemical compound that belongs to the class of piperidine derivatives. This substance typically features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, substituted with an ethyl group and an ethyl ester functional group. The presence of the carboxylate moiety suggests that it can participate in various chemical reactions, including esterification and hydrolysis. Ethyl 4-ethyl-4-piperidinecarboxylate is often characterized by its moderate polarity, which influences its solubility in organic solvents. Its molecular structure may impart specific biological activities, making it of interest in medicinal chemistry and drug development. Additionally, the compound's stability and reactivity can be affected by the steric and electronic effects of the substituents on the piperidine ring. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.

Formula: C₁₀H₁₉NO₂

InChI: InChI=1S/C10H19NO2/c1-3-10(9(12)13-4-2)5-7-11-8-6-10/h11H,3-8H2,1-2H3

InChI key: InChIKey=SWRKMDVRFPAIID-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1(CC)CCNCC1

Synonyms:

• Ethyl 4-ethyl-4-piperidinecarboxylate
• 4-Piperidinecarboxylic acid, 4-ethyl-, ethyl ester