CAS 874459-71-9
:B-[4-Methoxy-3-[(methylamino)sulfonyl]phenyl]boronic acid
Description:
B-[4-Methoxy-3-[(methylamino)sulfonyl]phenyl]boronic acid, with the CAS number 874459-71-9, is an organic compound that belongs to the class of boronic acids. It features a boron atom bonded to a phenyl ring that is substituted with a methoxy group and a sulfonamide moiety containing a methylamino group. This compound is characterized by its ability to form reversible covalent bonds with diols, making it useful in various applications, particularly in medicinal chemistry and as a reagent in organic synthesis. The presence of the boronic acid functional group allows for participation in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, the sulfonamide group can enhance the compound's solubility and biological activity. Overall, this compound's unique structural features contribute to its potential utility in drug development and other chemical processes.
Formula:C8H12BNO5S
InChI:InChI=1S/C8H12BNO5S/c1-10-16(13,14)8-5-6(9(11)12)3-4-7(8)15-2/h3-5,10-12H,1-2H3
InChI key:InChIKey=VMBGVCCSBNIGBZ-UHFFFAOYSA-N
SMILES:S(NC)(=O)(=O)C1=C(OC)C=CC(B(O)O)=C1
Synonyms:- [4-Methoxy-3-(methylsulfamoyl)phenyl]boronic acid
- Boronic acid, B-[4-methoxy-3-[(methylamino)sulfonyl]phenyl]-
- Boronic acid, [4-methoxy-3-[(methylamino)sulfonyl]phenyl]-
- B-[4-Methoxy-3-[(methylamino)sulfonyl]phenyl]boronic acid
- (4-Methoxy-3-(N-methylsulfamoyl)phenyl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
