CAS 874459-82-2

B-[2-(1-Piperidinylcarbonyl)phenyl]boronic acid

Description:

B-[2-(1-Piperidinylcarbonyl)phenyl]boronic acid, identified by its CAS number 874459-82-2, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a piperidinylcarbonyl moiety. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The piperidinyl group contributes to its potential biological activity, possibly enhancing its interaction with biological targets. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are vital in the formation of carbon-carbon bonds in organic synthesis. The compound's solubility and reactivity can vary based on the pH and the presence of other functional groups, influencing its utility in chemical reactions and biological systems. Overall, B-[2-(1-Piperidinylcarbonyl)phenyl]boronic acid represents a versatile building block in the development of pharmaceuticals and agrochemicals.

Formula: C₁₂H₁₆BNO₃

InChI: InChI=1S/C12H16BNO3/c15-12(14-8-4-1-5-9-14)10-6-2-3-7-11(10)13(16)17/h2-3,6-7,16-17H,1,4-5,8-9H2

InChI key: InChIKey=NZLRMOMHBWMLCA-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(B(O)O)C=CC=C1)N2CCCCC2

Synonyms:

• [2-(Piperidine-1-carbonyl)phenyl]boronic acid
• Boronic acid, B-[2-(1-piperidinylcarbonyl)phenyl]-
• Boronic acid, [2-(1-piperidinylcarbonyl)phenyl]-
• B-[2-(1-Piperidinylcarbonyl)phenyl]boronic acid

BORONIC ACID, [2-(1-PIPERIDINYLCARBONYL)PHENYL]-

CAS: 874459-82-2

Formula: C₁₂H₁₆BNO₃

Molecular weight: 233.0713

Ref: IN-DA00H1OT