CymitQuimica logo

CAS 874459-89-9

:

B-[4-[(2-Propyn-1-ylamino)carbonyl]phenyl]boronic acid

Description:
B-[4-[(2-Propyn-1-ylamino)carbonyl]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a carbonyl group linked to a propynylamino moiety, contributing to its potential reactivity and biological activity. The boronic acid group imparts properties such as water solubility and the ability to participate in Suzuki coupling reactions, which are valuable in the formation of carbon-carbon bonds. Additionally, the presence of the amino group may enhance its interaction with biological targets, suggesting potential applications in drug development. Overall, this compound exemplifies the versatility of boronic acids in synthetic and medicinal chemistry, with its unique structural features enabling a range of chemical reactivity and biological interactions.
Formula:C10H10BNO3
InChI:InChI=1S/C10H10BNO3/c1-2-7-12-10(13)8-3-5-9(6-4-8)11(14)15/h1,3-6,14-15H,7H2,(H,12,13)
InChI key:InChIKey=HKEKSLIZBDCTPR-UHFFFAOYSA-N
SMILES:C(NCC#C)(=O)C1=CC=C(B(O)O)C=C1
Synonyms:
  • Boronic acid, B-[4-[(2-propyn-1-ylamino)carbonyl]phenyl]-
  • B-[4-[(2-Propyn-1-ylamino)carbonyl]phenyl]boronic acid
  • Boronic acid, [4-[(2-propynylamino)carbonyl]phenyl]-
  • (4-(Prop-2-yn-1-ylcarbamoyl)phenyl)boronicacid
  • (4-(Prop-2-yn-1-ylcarbamoyl)phenyl)boronic acid
Found 4 products.