CAS 874462-72-3
:benzyl (2S)-2-(benzyloxycarbonylamino)-5-[[(1R)-2-[(2-benzyloxy-2-oxo-ethyl)amino]-1-(benzylsulfanylmethyl)-2-oxo-ethyl]amino]-5-oxo-pentanoate
Description:
Benzyl (2S)-2-(benzyloxycarbonylamino)-5-[[(1R)-2-[(2-benzyloxy-2-oxo-ethyl)amino]-1-(benzylsulfanylmethyl)-2-oxo-ethyl]amino]-5-oxo-pentanoate, identified by CAS number 874462-72-3, is a complex organic compound characterized by its multi-functional structure, which includes multiple amine and carbonyl groups. This compound features a pentanoate backbone, indicating it is an ester, and contains benzyloxy and benzyl groups that contribute to its hydrophobic characteristics. The presence of chiral centers in its structure suggests that it may exhibit stereoisomerism, which can influence its biological activity and interactions. The compound's potential applications may lie in medicinal chemistry, particularly in the development of pharmaceuticals, due to its intricate structure that may interact with biological targets. Its solubility, stability, and reactivity would depend on the specific functional groups present, making it a subject of interest for further research in synthetic and medicinal chemistry.
Formula:C3713C2H41N215NO8S
InChI:InChI=1/C39H41N3O8S/c43-35(22-21-33(38(46)49-25-30-15-7-2-8-16-30)42-39(47)50-26-31-17-9-3-10-18-31)41-34(28-51-27-32-19-11-4-12-20-32)37(45)40-23-36(44)48-24-29-13-5-1-6-14-29/h1-20,33-34H,21-28H2,(H,40,45)(H,41,43)(H,42,47)/t33-,34-/m0/s1/i23+1,36+1,40+1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Cbz-O-Bzl-L-Glu-S-Bzl-L-Cys-Gly[13C2,15N]-OBzl
CAS:Controlled ProductFormula:C2C37H4115NN2O8SColor and Shape:NeatMolecular weight:714.80
