CAS 874463-07-7
:2-ethylsulfanyl-1,3-benzoxazol-6-amine
Description:
2-Ethylsulfanyl-1,3-benzoxazol-6-amine is an organic compound characterized by its unique structure, which includes a benzoxazole ring fused with an amine group and an ethylsulfanyl substituent. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in polar solvents and potential reactivity due to the presence of the amine group. The benzoxazole moiety contributes to its aromatic character, which can influence its stability and reactivity. Additionally, the ethylsulfanyl group may impart specific electronic and steric effects, potentially affecting the compound's biological activity and interactions with other molecules. Compounds of this nature are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The presence of both sulfur and nitrogen in the structure may also suggest interesting properties related to coordination chemistry or catalysis. Overall, 2-ethylsulfanyl-1,3-benzoxazol-6-amine represents a class of compounds that can be explored for various chemical and biological applications.
Formula:C9H10N2OS
InChI:InChI=1/C9H10N2OS/c1-2-13-9-11-7-4-3-6(10)5-8(7)12-9/h3-5H,2,10H2,1H3
SMILES:CCSc1nc2ccc(cc2o1)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
