CAS 874468-52-7

5-(3-Amino-4-methylphenyl)-2-furanmethanol

Description:

5-(3-Amino-4-methylphenyl)-2-furanmethanol, with the CAS number 874468-52-7, is an organic compound characterized by its unique structure that includes a furan ring and an amino-substituted aromatic system. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the hydroxyl (-OH) group, which enhances its hydrogen bonding capabilities. The amino group contributes to its potential as a building block in pharmaceuticals or agrochemicals, as it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the furan moiety may impart additional reactivity and biological activity, making it of interest in medicinal chemistry. Furthermore, the compound's molecular structure suggests potential applications in the development of dyes, ligands, or other functional materials. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a versatile structure with potential applications in various fields of chemistry.

Formula: C₁₂H₁₃NO₂

InChI: InChI=1S/C12H13NO2/c1-8-2-3-9(6-11(8)13)12-5-4-10(7-14)15-12/h2-6,14H,7,13H2,1H3

InChI key: InChIKey=JCVNEKSUAUHIEG-UHFFFAOYSA-N

SMILES: C(O)C=1OC(=CC1)C2=CC(N)=C(C)C=C2

Synonyms:

• 2-Furanmethanol, 5-(3-amino-4-methylphenyl)-
• 5-(3-Amino-4-methylphenyl)-2-furanmethanol